C24H25N3 — CID 101458975
1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine (PubChem CID 101458975) has the molecular formula C24H25N3 and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine.
| Compound Name | 1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine |
|---|---|
| PubChem CID | 101458975 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine |
| SMILES | C/C(=N\c1ccccc1)c1cccc(/C(C)=N/c2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C24H25N3/c1-16-14-17(2)24(18(3)15-16)26-20(5)23-13-9-12-22(27-23)19(4)25-21-10-7-6-8-11-21/h6-15H,1-5H3/b25-19+,26-20+ |
| InChIKey | ZFMZYQHXOFVIHT-FQHZWJPGSA-N |
| XLogP | 6.29 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|