C22H21N3 — CID 177189173
1-[6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine (PubChem CID 177189173) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine.
| Compound Name | 1-[6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine |
|---|---|
| PubChem CID | 177189173 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-2-pyridinyl]-N-phenylethanimine |
| SMILES | C/C(=N\c1ccccc1)c1cccc(/C(C)=N/c2ccccc2C)n1 |
| InChI | InChI=1S/C22H21N3/c1-16-10-7-8-13-20(16)24-18(3)22-15-9-14-21(25-22)17(2)23-19-11-5-4-6-12-19/h4-15H,1-3H3/b23-17+,24-18+ |
| InChIKey | PZEIGMYOXKLODK-GJHDBBOXSA-N |
| XLogP | 5.67 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|