C25H27Cl2CoN3 — CID 140748189
1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-phenylethanimine;dichlorocobalt (PubChem CID 140748189) has the molecular formula C25H27Cl2CoN3 and a molecular weight of 499.35 g/mol. Its IUPAC name is 1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-phenylethanimine;dichlorocobalt.
| Compound Name | 1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-phenylethanimine;dichlorocobalt |
|---|---|
| PubChem CID | 140748189 |
| Molecular Formula | C25H27Cl2CoN3 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-phenylethanimine;dichlorocobalt |
| SMILES | C/C(=N\c1ccccc1)c1cccc(/C(C)=N/c2ccccc2C(C)(C)C)n1.Cl[Co]Cl |
| InChI | InChI=1S/C25H27N3.2ClH.Co/c1-18(26-20-12-7-6-8-13-20)22-16-11-17-23(28-22)19(2)27-24-15-10-9-14-21(24)25(3,4)5;;;/h6-17H,1-5H3;2*1H;/q;;;+2/p-2/b26-18+,27-19+;;; |
| InChIKey | PRFISCPIFAMQLE-MBYIOEMKSA-L |
| XLogP | 8.04 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|