C27H33Cl2FeN5 — CID 140654375
N-(2-tert-butylphenyl)-1-[4-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine;dichloroiron (PubChem CID 140654375) has the molecular formula C27H33Cl2FeN5 and a molecular weight of 554.35 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-1-[4-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine;dichloroiron.
| Compound Name | N-(2-tert-butylphenyl)-1-[4-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine;dichloroiron |
|---|---|
| PubChem CID | 140654375 |
| Molecular Formula | C27H33Cl2FeN5 |
| Molecular Weight | 554.35 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | N-(2-tert-butylphenyl)-1-[4-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine;dichloroiron |
| SMILES | C/C(=N\c1ccccc1C(C)(C)C)c1ncnc(/C(C)=N/c2ccccc2C(C)(C)C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C27H33N5.2ClH.Fe/c1-18(30-22-15-11-9-13-20(22)26(3,4)5)24-28-17-29-25(32-24)19(2)31-23-16-12-10-14-21(23)27(6,7)8;;;/h9-17H,1-8H3;2*1H;/q;;;+2/p-2/b30-18+,31-19+;;; |
| InChIKey | LBPZVXYVHSEYEL-HOZDODFKSA-L |
| XLogP | 8.12 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.35 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|