C29H35Cl2FeN3 — CID 23569042
N-(4-tert-butylphenyl)-1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron (PubChem CID 23569042) has the molecular formula C29H35Cl2FeN3 and a molecular weight of 552.37 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron.
| Compound Name | N-(4-tert-butylphenyl)-1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron |
|---|---|
| PubChem CID | 23569042 |
| Molecular Formula | C29H35Cl2FeN3 |
| Molecular Weight | 552.37 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-[6-[N-(2-tert-butylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron |
| SMILES | C/C(=N\c1ccc(C(C)(C)C)cc1)c1cccc(/C(C)=N/c2ccccc2C(C)(C)C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C29H35N3.2ClH.Fe/c1-20(30-23-18-16-22(17-19-23)28(3,4)5)25-14-11-15-26(32-25)21(2)31-27-13-10-9-12-24(27)29(6,7)8;;;/h9-19H,1-8H3;2*1H;/q;;;+2/p-2/b30-20+,31-21+;;; |
| InChIKey | LSLLYTPPLACJPU-UKRCUSNJSA-L |
| XLogP | 9.33 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.37 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|