C21H17Br2F2N3Ni — CID 140582338
dibromonickel;N-(4-fluorophenyl)-1-[6-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine (PubChem CID 140582338) has the molecular formula C21H17Br2F2N3Ni and a molecular weight of 567.89 g/mol. Its IUPAC name is dibromonickel;N-(4-fluorophenyl)-1-[6-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine.
| Compound Name | dibromonickel;N-(4-fluorophenyl)-1-[6-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 140582338 |
| Molecular Formula | C21H17Br2F2N3Ni |
| Molecular Weight | 567.89 g/mol |
| Exact Mass | 564.91 |
| IUPAC Name | dibromonickel;N-(4-fluorophenyl)-1-[6-[N-(4-fluorophenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine |
| SMILES | Br[Ni]Br.C/C(=N\c1ccc(F)cc1)c1cccc(/C(C)=N/c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H17F2N3.2BrH.Ni/c1-14(24-18-10-6-16(22)7-11-18)20-4-3-5-21(26-20)15(2)25-19-12-8-17(23)9-13-19;;;/h3-13H,1-2H3;2*1H;/q;;;+2/p-2/b24-14+,25-15+;;; |
| InChIKey | MAOHJLBBPHYXLM-YMCUJNOTSA-L |
| XLogP | 7.33 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.89 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|