C23H22Cl2N4Ru — CID 139238297
acetonitrile;dichlororuthenium;1-[6-(C-methyl-N-phenylcarbonimidoyl)-2-pyridinyl]-N-phenylethanimine (PubChem CID 139238297) has the molecular formula C23H22Cl2N4Ru and a molecular weight of 526.43 g/mol. Its IUPAC name is acetonitrile;dichlororuthenium;1-[6-(C-methyl-N-phenylcarbonimidoyl)-2-pyridinyl]-N-phenylethanimine.
| Compound Name | acetonitrile;dichlororuthenium;1-[6-(C-methyl-N-phenylcarbonimidoyl)-2-pyridinyl]-N-phenylethanimine |
|---|---|
| PubChem CID | 139238297 |
| Molecular Formula | C23H22Cl2N4Ru |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | acetonitrile;dichlororuthenium;1-[6-(C-methyl-N-phenylcarbonimidoyl)-2-pyridinyl]-N-phenylethanimine |
| SMILES | C/C(=N\c1ccccc1)c1cccc(/C(C)=N/c2ccccc2)n1.CC#N.Cl[Ru]Cl |
| InChI | InChI=1S/C21H19N3.C2H3N.2ClH.Ru/c1-16(22-18-10-5-3-6-11-18)20-14-9-15-21(24-20)17(2)23-19-12-7-4-8-13-19;1-2-3;;;/h3-15H,1-2H3;1H3;2*1H;/q;;;;+2/p-2/b22-16+,23-17+;;;; |
| InChIKey | PACNSUSDAFYKPO-FFTATXDDSA-L |
| XLogP | 7.27 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|