C25H29N5 — CID 90737220
4-[1-[6-[N-[4-(dimethylamino)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylaniline (PubChem CID 90737220) has the molecular formula C25H29N5 and a molecular weight of 399.54 g/mol. Its IUPAC name is 4-[1-[6-[N-[4-(dimethylamino)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[1-[6-[N-[4-(dimethylamino)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 90737220 |
| Molecular Formula | C25H29N5 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 4-[1-[6-[N-[4-(dimethylamino)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylaniline |
| SMILES | C/C(=N\c1ccc(N(C)C)cc1)c1cccc(/C(C)=N/c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C25H29N5/c1-18(26-20-10-14-22(15-11-20)29(3)4)24-8-7-9-25(28-24)19(2)27-21-12-16-23(17-13-21)30(5)6/h7-17H,1-6H3/b26-18+,27-19+ |
| InChIKey | FNTQWNMBWHXCHR-BFNWXZRRSA-N |
| XLogP | 5.49 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|