C13H21N5 — CID 15522728
N-[(E)-1-[6-[(E)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N-methylmethanamine (PubChem CID 15522728) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-[(E)-1-[6-[(E)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-1-[6-[(E)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 15522728 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-[(E)-1-[6-[(E)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N-methylmethanamine |
| SMILES | C/C(=N\N(C)C)c1cccc(/C(C)=N/N(C)C)n1 |
| InChI | InChI=1S/C13H21N5/c1-10(15-17(3)4)12-8-7-9-13(14-12)11(2)16-18(5)6/h7-9H,1-6H3/b15-10+,16-11+ |
| InChIKey | PBISVHGIXVUZJF-RWPWKDLBSA-N |
| XLogP | 1.65 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|