C10H12F2N2 — CID 59962068
N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]-N-methylmethanamine (PubChem CID 59962068) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 59962068 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]-N-methylmethanamine |
| SMILES | C/C(=N\N(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2N2/c1-7(13-14(2)3)10-8(11)5-4-6-9(10)12/h4-6H,1-3H3/b13-7+ |
| InChIKey | YMOPSJBFWHAETC-NTUHNPAUSA-N |
| XLogP | 2.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|