C8H7F2NO — CID 71464288
(NZ)-N-[1-(2,6-difluorophenyl)ethylidene]hydroxylamine (PubChem CID 71464288) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is (NZ)-N-[1-(2,6-difluorophenyl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2,6-difluorophenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 71464288 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (NZ)-N-[1-(2,6-difluorophenyl)ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1c(F)cccc1F |
| InChI | InChI=1S/C8H7F2NO/c1-5(11-12)8-6(9)3-2-4-7(8)10/h2-4,12H,1H3/b11-5- |
| InChIKey | JRXOMHDOIJWJQP-WZUFQYTHSA-N |
| XLogP | 2.16 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|