About N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide
N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide (PubChem CID 123611073) has the molecular formula C10H10F2N2
and a molecular weight of 196.20 g/mol. Its IUPAC name is N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide |
| PubChem CID | 123611073 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide |
| SMILES | C=C(/N=C(\C)N)c1c(F)cccc1F |
| InChI | InChI=1S/C10H10F2N2/c1-6(14-7(2)13)10-8(11)4-3-5-9(10)12/h3-5H,1H2,2H3,(H2,13,14) |
| InChIKey | BJKQINVRAHRVJQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide?
The IUPAC name of N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide (CID 123611073) is N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide.
What is the SMILES notation for N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide?
The canonical SMILES for N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide is C=C(/N=C(\C)N)c1c(F)cccc1F.
What is the InChIKey of N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide?
The InChIKey is BJKQINVRAHRVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2/c1-6(14-7(2)13)10-8(11)4-3-5-9(10)12/h3-5H,1H2,2H3,(H2,13,14).
What are the key properties of N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide?
N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide has a molecular weight of 196.20 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide is sourced from PubChem (CID 123611073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).