C10H10F2N2 — CID 123611073
N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide (PubChem CID 123611073) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide.
| Compound Name | N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide |
|---|---|
| PubChem CID | 123611073 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N'-[1-(2,6-difluorophenyl)ethenyl]ethanimidamide |
| SMILES | C=C(/N=C(\C)N)c1c(F)cccc1F |
| InChI | InChI=1S/C10H10F2N2/c1-6(14-7(2)13)10-8(11)4-3-5-9(10)12/h3-5H,1H2,2H3,(H2,13,14) |
| InChIKey | BJKQINVRAHRVJQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|