C15H12F2 — CID 156698109
1,3-difluoro-2-[1-(4-methylphenyl)ethenyl]benzene (PubChem CID 156698109) has the molecular formula C15H12F2 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1,3-difluoro-2-[1-(4-methylphenyl)ethenyl]benzene.
| Compound Name | 1,3-difluoro-2-[1-(4-methylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 156698109 |
| Molecular Formula | C15H12F2 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1,3-difluoro-2-[1-(4-methylphenyl)ethenyl]benzene |
| SMILES | C=C(c1ccc(C)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H12F2/c1-10-6-8-12(9-7-10)11(2)15-13(16)4-3-5-14(15)17/h3-9H,2H2,1H3 |
| InChIKey | WLOQMDXJPADYEV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |