C9H13Al2N3 — CID 147119657
N-alumanyl-1-[6-(N-alumanyl-C-methylcarbonimidoyl)-2-pyridinyl]ethanimine (PubChem CID 147119657) has the molecular formula C9H13Al2N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is N-alumanyl-1-[6-(N-alumanyl-C-methylcarbonimidoyl)-2-pyridinyl]ethanimine.
| Compound Name | N-alumanyl-1-[6-(N-alumanyl-C-methylcarbonimidoyl)-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 147119657 |
| Molecular Formula | C9H13Al2N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-alumanyl-1-[6-(N-alumanyl-C-methylcarbonimidoyl)-2-pyridinyl]ethanimine |
| SMILES | CC(=N[AlH2])c1cccc(C(C)=N[AlH2])n1 |
| InChI | InChI=1S/C9H9N3.2Al.4H/c1-6(10)8-4-3-5-9(12-8)7(2)11;;;;;;/h3-5H,1-2H3;;;;;;/q-2;2*+1;;;; |
| InChIKey | CCXUTMHBBVZMSV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|