C20H35N5Rh — CID 140723720
4-[1-[6-[N-[3-(dimethylamino)propyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylbutan-1-amine;rhodium (PubChem CID 140723720) has the molecular formula C20H35N5Rh and a molecular weight of 448.44 g/mol. Its IUPAC name is 4-[1-[6-[N-[3-(dimethylamino)propyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylbutan-1-amine;rhodium.
| Compound Name | 4-[1-[6-[N-[3-(dimethylamino)propyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylbutan-1-amine;rhodium |
|---|---|
| PubChem CID | 140723720 |
| Molecular Formula | C20H35N5Rh |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-[1-[6-[N-[3-(dimethylamino)propyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]-N,N-dimethylbutan-1-amine;rhodium |
| SMILES | C/C(=N\CCCCN(C)C)c1cccc(/C(C)=N/CCCN(C)C)n1.[Rh] |
| InChI | InChI=1S/C20H35N5.Rh/c1-17(21-13-7-8-15-24(3)4)19-11-9-12-20(23-19)18(2)22-14-10-16-25(5)6;/h9,11-12H,7-8,10,13-16H2,1-6H3;/b21-17+,22-18+; |
| InChIKey | LEUTXBOUQCPFDU-FCJWRILLSA-N |
| XLogP | 2.99 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|