C42H47N3P2 — CID 130233405
1-[6-[N-[2-(diphenylphosphanylmethyl)pentyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(3-diphenylphosphanylpropyl)ethanimine (PubChem CID 130233405) has the molecular formula C42H47N3P2 and a molecular weight of 655.81 g/mol. Its IUPAC name is 1-[6-[N-[2-(diphenylphosphanylmethyl)pentyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(3-diphenylphosphanylpropyl)ethanimine.
| Compound Name | 1-[6-[N-[2-(diphenylphosphanylmethyl)pentyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(3-diphenylphosphanylpropyl)ethanimine |
|---|---|
| PubChem CID | 130233405 |
| Molecular Formula | C42H47N3P2 |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.32 |
| IUPAC Name | 1-[6-[N-[2-(diphenylphosphanylmethyl)pentyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(3-diphenylphosphanylpropyl)ethanimine |
| SMILES | CCCC(C/N=C(\C)c1cccc(/C(C)=N/CCCP(c2ccccc2)c2ccccc2)n1)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H47N3P2/c1-4-19-36(33-47(39-24-13-7-14-25-39)40-26-15-8-16-27-40)32-44-35(3)42-29-17-28-41(45-42)34(2)43-30-18-31-46(37-20-9-5-10-21-37)38-22-11-6-12-23-38/h5-17,20-29,36H,4,18-19,30-33H2,1-3H3/b43-34+,44-35+ |
| InChIKey | ZSAUUXNTPFHZIC-PLJIOEQVSA-N |
| XLogP | 8.77 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|