About butyl(diphenyl)phosphane;chloroplatinum
butyl(diphenyl)phosphane;chloroplatinum (PubChem CID 175284434) has the molecular formula C16H19ClPPt
and a molecular weight of 472.83 g/mol. Its IUPAC name is butyl(diphenyl)phosphane;chloroplatinum.
Molecular Properties
| Compound Name | butyl(diphenyl)phosphane;chloroplatinum |
| PubChem CID | 175284434 |
| Molecular Formula | C16H19ClPPt |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | butyl(diphenyl)phosphane;chloroplatinum |
| SMILES | CCCCP(c1ccccc1)c1ccccc1.Cl[Pt] |
| InChI | InChI=1S/C16H19P.ClH.Pt/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;;/h4-13H,2-3,14H2,1H3;1H;/q;;+1/p-1 |
| InChIKey | KQEOYIXOZDNPEQ-UHFFFAOYSA-M |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butyl(diphenyl)phosphane;chloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(diphenyl)phosphane;chloroplatinum?
The IUPAC name of butyl(diphenyl)phosphane;chloroplatinum (CID 175284434) is butyl(diphenyl)phosphane;chloroplatinum.
What is the SMILES notation for butyl(diphenyl)phosphane;chloroplatinum?
The canonical SMILES for butyl(diphenyl)phosphane;chloroplatinum is CCCCP(c1ccccc1)c1ccccc1.Cl[Pt].
What is the InChIKey of butyl(diphenyl)phosphane;chloroplatinum?
The InChIKey is KQEOYIXOZDNPEQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H19P.ClH.Pt/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;;/h4-13H,2-3,14H2,1H3;1H;/q;;+1/p-1.
What are the key properties of butyl(diphenyl)phosphane;chloroplatinum?
butyl(diphenyl)phosphane;chloroplatinum has a molecular weight of 472.83 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(diphenyl)phosphane;chloroplatinum is sourced from PubChem (CID 175284434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).