About dichloroiron;diphenyl(propyl)phosphane
dichloroiron;diphenyl(propyl)phosphane (PubChem CID 175149268) has the molecular formula C15H17Cl2FeP
and a molecular weight of 355.03 g/mol. Its IUPAC name is dichloroiron;diphenyl(propyl)phosphane.
Molecular Properties
| Compound Name | dichloroiron;diphenyl(propyl)phosphane |
| PubChem CID | 175149268 |
| Molecular Formula | C15H17Cl2FeP |
| Molecular Weight | 355.03 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | dichloroiron;diphenyl(propyl)phosphane |
| SMILES | CCCP(c1ccccc1)c1ccccc1.Cl[Fe]Cl |
| InChI | InChI=1S/C15H17P.2ClH.Fe/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;;;/h3-12H,2,13H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | TWPWLBXAEVRUJT-UHFFFAOYSA-L |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;diphenyl(propyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;diphenyl(propyl)phosphane?
The IUPAC name of dichloroiron;diphenyl(propyl)phosphane (CID 175149268) is dichloroiron;diphenyl(propyl)phosphane.
What is the SMILES notation for dichloroiron;diphenyl(propyl)phosphane?
The canonical SMILES for dichloroiron;diphenyl(propyl)phosphane is CCCP(c1ccccc1)c1ccccc1.Cl[Fe]Cl.
What is the InChIKey of dichloroiron;diphenyl(propyl)phosphane?
The InChIKey is TWPWLBXAEVRUJT-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H17P.2ClH.Fe/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;;;/h3-12H,2,13H2,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroiron;diphenyl(propyl)phosphane?
dichloroiron;diphenyl(propyl)phosphane has a molecular weight of 355.03 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;diphenyl(propyl)phosphane is sourced from PubChem (CID 175149268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).