C26H35N3 — CID 102031866
1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-pent-4-enylethanimine (PubChem CID 102031866) has the molecular formula C26H35N3 and a molecular weight of 389.59 g/mol. Its IUPAC name is 1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-pent-4-enylethanimine.
| Compound Name | 1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-pent-4-enylethanimine |
|---|---|
| PubChem CID | 102031866 |
| Molecular Formula | C26H35N3 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-pent-4-enylethanimine |
| SMILES | C=CCCC/N=C(\C)c1cccc(/C(C)=N/c2c(C(C)C)cccc2C(C)C)n1 |
| InChI | InChI=1S/C26H35N3/c1-8-9-10-17-27-20(6)24-15-12-16-25(29-24)21(7)28-26-22(18(2)3)13-11-14-23(26)19(4)5/h8,11-16,18-19H,1,9-10,17H2,2-7H3/b27-20+,28-21+ |
| InChIKey | BXDQXXGRWSYIHL-KUKFKUQFSA-N |
| XLogP | 7.24 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|