C28H32Cl3FeN3 — CID 161432910
N-(2-chloro-6-methylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron (PubChem CID 161432910) has the molecular formula C28H32Cl3FeN3 and a molecular weight of 572.79 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron.
| Compound Name | N-(2-chloro-6-methylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron |
|---|---|
| PubChem CID | 161432910 |
| Molecular Formula | C28H32Cl3FeN3 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron |
| SMILES | C/C(=N\c1c(C)cccc1Cl)c1cccc(/C(C)=N/c2c(C(C)C)cccc2C(C)C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C28H32ClN3.2ClH.Fe/c1-17(2)22-12-9-13-23(18(3)4)28(22)31-21(7)26-16-10-15-25(32-26)20(6)30-27-19(5)11-8-14-24(27)29;;;/h8-18H,1-7H3;2*1H;/q;;;+2/p-2/b30-20+,31-21+;;; |
| InChIKey | VYGJQMLSHVFIDX-UKRCUSNJSA-L |
| XLogP | 9.95 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|