C31H41Cl2FeN5 — CID 140654190
dichloroiron;N-[2,6-di(propan-2-yl)phenyl]-1-[4-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine (PubChem CID 140654190) has the molecular formula C31H41Cl2FeN5 and a molecular weight of 610.46 g/mol. Its IUPAC name is dichloroiron;N-[2,6-di(propan-2-yl)phenyl]-1-[4-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine.
| Compound Name | dichloroiron;N-[2,6-di(propan-2-yl)phenyl]-1-[4-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine |
|---|---|
| PubChem CID | 140654190 |
| Molecular Formula | C31H41Cl2FeN5 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | dichloroiron;N-[2,6-di(propan-2-yl)phenyl]-1-[4-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-1,3,5-triazin-2-yl]ethanimine |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)c1ncnc(/C(C)=N/c2c(C(C)C)cccc2C(C)C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C31H41N5.2ClH.Fe/c1-18(2)24-13-11-14-25(19(3)4)28(24)34-22(9)30-32-17-33-31(36-30)23(10)35-29-26(20(5)6)15-12-16-27(29)21(7)8;;;/h11-21H,1-10H3;2*1H;/q;;;+2/p-2/b34-22+,35-23+;;; |
| InChIKey | WDMGDSITEJOSID-XMXGQCKWSA-L |
| XLogP | 10.02 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|