C37H53Cl2FeN5 — CID 140654124
dichloroiron;1-[4-[C-methyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbonimidoyl]-1,3,5-triazin-2-yl]-N-[2,4,6-tri(propan-2-yl)phenyl]ethanimine (PubChem CID 140654124) has the molecular formula C37H53Cl2FeN5 and a molecular weight of 694.62 g/mol. Its IUPAC name is dichloroiron;1-[4-[C-methyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbonimidoyl]-1,3,5-triazin-2-yl]-N-[2,4,6-tri(propan-2-yl)phenyl]ethanimine.
| Compound Name | dichloroiron;1-[4-[C-methyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbonimidoyl]-1,3,5-triazin-2-yl]-N-[2,4,6-tri(propan-2-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 140654124 |
| Molecular Formula | C37H53Cl2FeN5 |
| Molecular Weight | 694.62 g/mol |
| Exact Mass | 693.30 |
| IUPAC Name | dichloroiron;1-[4-[C-methyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbonimidoyl]-1,3,5-triazin-2-yl]-N-[2,4,6-tri(propan-2-yl)phenyl]ethanimine |
| SMILES | C/C(=N\c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1ncnc(/C(C)=N/c2c(C(C)C)cc(C(C)C)cc2C(C)C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C37H53N5.2ClH.Fe/c1-20(2)28-15-30(22(5)6)34(31(16-28)23(7)8)40-26(13)36-38-19-39-37(42-36)27(14)41-35-32(24(9)10)17-29(21(3)4)18-33(35)25(11)12;;;/h15-25H,1-14H3;2*1H;/q;;;+2/p-2/b40-26+,41-27+;;; |
| InChIKey | GGLBLCPVIDNPMQ-MYEAJWJCSA-L |
| XLogP | 12.27 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.62 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|