C28H38Cl2N2 — CID 102208627
2-N,3-N-bis[4-chloro-2,6-di(propan-2-yl)phenyl]butane-2,3-diimine (PubChem CID 102208627) has the molecular formula C28H38Cl2N2 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-N,3-N-bis[4-chloro-2,6-di(propan-2-yl)phenyl]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[4-chloro-2,6-di(propan-2-yl)phenyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 102208627 |
| Molecular Formula | C28H38Cl2N2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-N,3-N-bis[4-chloro-2,6-di(propan-2-yl)phenyl]butane-2,3-diimine |
| SMILES | CC(=N\c1c(C(C)C)cc(Cl)cc1C(C)C)/C(C)=N/c1c(C(C)C)cc(Cl)cc1C(C)C |
| InChI | InChI=1S/C28H38Cl2N2/c1-15(2)23-11-21(29)12-24(16(3)4)27(23)31-19(9)20(10)32-28-25(17(5)6)13-22(30)14-26(28)18(7)8/h11-18H,1-10H3/b31-19+,32-20+ |
| InChIKey | OACWMIRRURUKLD-GKTLAHRSSA-N |
| XLogP | 10.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|