C28H38N2Na2O6S2 — CID 102520147
disodium;4-[3-[2,6-di(propan-2-yl)-4-sulfonatophenyl]iminobutan-2-ylideneamino]-3,5-di(propan-2-yl)benzenesulfonate (PubChem CID 102520147) has the molecular formula C28H38N2Na2O6S2 and a molecular weight of 608.73 g/mol. Its IUPAC name is disodium;4-[3-[2,6-di(propan-2-yl)-4-sulfonatophenyl]iminobutan-2-ylideneamino]-3,5-di(propan-2-yl)benzenesulfonate.
| Compound Name | disodium;4-[3-[2,6-di(propan-2-yl)-4-sulfonatophenyl]iminobutan-2-ylideneamino]-3,5-di(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 102520147 |
| Molecular Formula | C28H38N2Na2O6S2 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | disodium;4-[3-[2,6-di(propan-2-yl)-4-sulfonatophenyl]iminobutan-2-ylideneamino]-3,5-di(propan-2-yl)benzenesulfonate |
| SMILES | CC(=N\c1c(C(C)C)cc(S(=O)(=O)[O-])cc1C(C)C)/C(C)=N/c1c(C(C)C)cc(S(=O)(=O)[O-])cc1C(C)C.[Na+].[Na+] |
| InChI | InChI=1S/C28H40N2O6S2.2Na/c1-15(2)23-11-21(37(31,32)33)12-24(16(3)4)27(23)29-19(9)20(10)30-28-25(17(5)6)13-22(38(34,35)36)14-26(28)18(7)8;;/h11-18H,1-10H3,(H,31,32,33)(H,34,35,36);;/q;2*+1/p-2/b29-19+,30-20+;; |
| InChIKey | DHGNXJIIEZJGTP-BEYAFGAESA-L |
| XLogP | 0.88 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|