C39H39N3 — CID 23567899
N-(2,6-diphenylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine (PubChem CID 23567899) has the molecular formula C39H39N3 and a molecular weight of 549.76 g/mol. Its IUPAC name is N-(2,6-diphenylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine.
| Compound Name | N-(2,6-diphenylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 23567899 |
| Molecular Formula | C39H39N3 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | N-(2,6-diphenylphenyl)-1-[6-[N-[2,6-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine |
| SMILES | C/C(=N\c1c(-c2ccccc2)cccc1-c1ccccc1)c1cccc(/C(C)=N/c2c(C(C)C)cccc2C(C)C)n1 |
| InChI | InChI=1S/C39H39N3/c1-26(2)32-20-13-21-33(27(3)4)38(32)40-28(5)36-24-15-25-37(42-36)29(6)41-39-34(30-16-9-7-10-17-30)22-14-23-35(39)31-18-11-8-12-19-31/h7-27H,1-6H3/b40-28+,41-29+ |
| InChIKey | FZOWDCPBABBGGL-ICKILNQYSA-N |
| XLogP | 10.94 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|