C33H27N3 — CID 58927833
1-[6-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2-phenylphenyl)ethanimine (PubChem CID 58927833) has the molecular formula C33H27N3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-[6-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2-phenylphenyl)ethanimine.
| Compound Name | 1-[6-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2-phenylphenyl)ethanimine |
|---|---|
| PubChem CID | 58927833 |
| Molecular Formula | C33H27N3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[6-[C-methyl-N-(2-phenylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2-phenylphenyl)ethanimine |
| SMILES | C/C(=N\c1ccccc1-c1ccccc1)c1cccc(/C(C)=N/c2ccccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C33H27N3/c1-24(34-32-20-11-9-18-28(32)26-14-5-3-6-15-26)30-22-13-23-31(36-30)25(2)35-33-21-12-10-19-29(33)27-16-7-4-8-17-27/h3-23H,1-2H3/b34-24+,35-25+ |
| InChIKey | LBMNXKGQJUGBGM-DNHJVCTKSA-N |
| XLogP | 8.70 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|