C17H16N2 — CID 39830827
2-(2,4,6-trimethylphenyl)quinoxaline (PubChem CID 39830827) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)quinoxaline.
| Compound Name | 2-(2,4,6-trimethylphenyl)quinoxaline |
|---|---|
| PubChem CID | 39830827 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)quinoxaline |
| SMILES | Cc1cc(C)c(-c2cnc3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C17H16N2/c1-11-8-12(2)17(13(3)9-11)16-10-18-14-6-4-5-7-15(14)19-16/h4-10H,1-3H3 |
| InChIKey | CQOJFGMYUDYYHJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |