C35H34Cl2FeN2OSi — CID 20701761
dichloroiron;(E)-1-[5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]furan-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 20701761) has the molecular formula C35H34Cl2FeN2OSi and a molecular weight of 653.51 g/mol. Its IUPAC name is dichloroiron;(E)-1-[5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]furan-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | dichloroiron;(E)-1-[5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]furan-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 20701761 |
| Molecular Formula | C35H34Cl2FeN2OSi |
| Molecular Weight | 653.51 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | dichloroiron;(E)-1-[5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]furan-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1ccc(/C(C)=N/[Si](c2ccccc2)(c2ccccc2)c2ccccc2)o1.Cl[Fe]Cl |
| InChI | InChI=1S/C35H34N2OSi.2ClH.Fe/c1-25-23-26(2)35(27(3)24-25)36-28(4)33-21-22-34(38-33)29(5)37-39(30-15-9-6-10-16-30,31-17-11-7-12-18-31)32-19-13-8-14-20-32;;;/h6-24H,1-5H3;2*1H;/q;;;+2/p-2/b36-28+,37-29+;;; |
| InChIKey | YCSSJHQQLXDVIX-UDZKADEWSA-L |
| XLogP | 8.20 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.51 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|