C32H24Cl2FeN2O — CID 20701711
1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-naphthalen-1-ylethanimine;dichloroiron (PubChem CID 20701711) has the molecular formula C32H24Cl2FeN2O and a molecular weight of 579.31 g/mol. Its IUPAC name is 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-naphthalen-1-ylethanimine;dichloroiron.
| Compound Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-naphthalen-1-ylethanimine;dichloroiron |
|---|---|
| PubChem CID | 20701711 |
| Molecular Formula | C32H24Cl2FeN2O |
| Molecular Weight | 579.31 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-naphthalen-1-ylethanimine;dichloroiron |
| SMILES | C/C(=N\c1cccc2ccccc12)c1ccc(/C(C)=N/c2c3ccccc3cc3ccccc23)o1.Cl[Fe]Cl |
| InChI | InChI=1S/C32H24N2O.2ClH.Fe/c1-21(33-29-17-9-13-23-10-3-6-14-26(23)29)30-18-19-31(35-30)22(2)34-32-27-15-7-4-11-24(27)20-25-12-5-8-16-28(25)32;;;/h3-20H,1-2H3;2*1H;/q;;;+2/p-2/b33-21+,34-22+;;; |
| InChIKey | COOMXZOZYOSTOK-XAHYBGMSSA-L |
| XLogP | 10.40 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.31 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|