C30H28Cl2FeN2O — CID 20702109
1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron (PubChem CID 20702109) has the molecular formula C30H28Cl2FeN2O and a molecular weight of 559.32 g/mol. Its IUPAC name is 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron.
| Compound Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron |
|---|---|
| PubChem CID | 20702109 |
| Molecular Formula | C30H28Cl2FeN2O |
| Molecular Weight | 559.32 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)furan-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron |
| SMILES | CC1=C(/N=C(\C)c2ccc(/C(C)=N/c3c4ccccc4cc4ccccc34)o2)C(C)CC=C1.Cl[Fe]Cl |
| InChI | InChI=1S/C30H28N2O.2ClH.Fe/c1-19-10-9-11-20(2)29(19)31-21(3)27-16-17-28(33-27)22(4)32-30-25-14-7-5-12-23(25)18-24-13-6-8-15-26(24)30;;;/h5-10,12-18,20H,11H2,1-4H3;2*1H;/q;;;+2/p-2/b31-21+,32-22+;;; |
| InChIKey | AUHLCLLAXNHBAI-YRVITRNUSA-L |
| XLogP | 9.78 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.32 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|