C29H25N3 — CID 18718620
1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-phenylethanimine (PubChem CID 18718620) has the molecular formula C29H25N3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-phenylethanimine.
| Compound Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-phenylethanimine |
|---|---|
| PubChem CID | 18718620 |
| Molecular Formula | C29H25N3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-phenylethanimine |
| SMILES | C/C(=N\c1ccccc1)c1ccc(/C(C)=N/c2c3ccccc3cc3ccccc23)n1C |
| InChI | InChI=1S/C29H25N3/c1-20(30-24-13-5-4-6-14-24)27-17-18-28(32(27)3)21(2)31-29-25-15-9-7-11-22(25)19-23-12-8-10-16-26(23)29/h4-19H,1-3H3/b30-20+,31-21+ |
| InChIKey | LGETZRGUEYXPBV-OQIGUVFWSA-N |
| XLogP | 7.61 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|