C16H18Cl2N2 — CID 172723144
2-N,3-N-diphenylbutane-2,3-diimine;dihydrochloride (PubChem CID 172723144) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-N,3-N-diphenylbutane-2,3-diimine;dihydrochloride.
| Compound Name | 2-N,3-N-diphenylbutane-2,3-diimine;dihydrochloride |
|---|---|
| PubChem CID | 172723144 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-N,3-N-diphenylbutane-2,3-diimine;dihydrochloride |
| SMILES | CC(=N\c1ccccc1)/C(C)=N/c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C16H16N2.2ClH/c1-13(17-15-9-5-3-6-10-15)14(2)18-16-11-7-4-8-12-16;;/h3-12H,1-2H3;2*1H/b17-13+,18-14+;; |
| InChIKey | GUDIRODBICKOPA-LMSDAIJJSA-N |
| XLogP | 5.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|