C16H16Br2FeN2 — CID 164938268
dibromoiron;2-N,3-N-diphenylbutane-2,3-diimine (PubChem CID 164938268) has the molecular formula C16H16Br2FeN2 and a molecular weight of 451.97 g/mol. Its IUPAC name is dibromoiron;2-N,3-N-diphenylbutane-2,3-diimine.
| Compound Name | dibromoiron;2-N,3-N-diphenylbutane-2,3-diimine |
|---|---|
| PubChem CID | 164938268 |
| Molecular Formula | C16H16Br2FeN2 |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 449.90 |
| IUPAC Name | dibromoiron;2-N,3-N-diphenylbutane-2,3-diimine |
| SMILES | Br[Fe]Br.CC(=N\c1ccccc1)/C(C)=N/c1ccccc1 |
| InChI | InChI=1S/C16H16N2.2BrH.Fe/c1-13(17-15-9-5-3-6-10-15)14(2)18-16-11-7-4-8-12-16;;;/h3-12H,1-2H3;2*1H;/q;;;+2/p-2/b17-13+,18-14+;;; |
| InChIKey | IUSMTLXWLAJTBZ-SQOWISFMSA-L |
| XLogP | 6.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|