About N-acetyl-N'-phenylcarbamimidoyl bromide
N-acetyl-N'-phenylcarbamimidoyl bromide (PubChem CID 137297946) has the molecular formula C9H9BrN2O
and a molecular weight of 241.09 g/mol. Its IUPAC name is N-acetyl-N'-phenylcarbamimidoyl bromide.
Molecular Properties
| Compound Name | N-acetyl-N'-phenylcarbamimidoyl bromide |
| PubChem CID | 137297946 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | N-acetyl-N'-phenylcarbamimidoyl bromide |
| SMILES | CC(=O)N/C(Br)=N/c1ccccc1 |
| InChI | InChI=1S/C9H9BrN2O/c1-7(13)11-9(10)12-8-5-3-2-4-6-8/h2-6H,1H3,(H,11,12,13) |
| InChIKey | CKQNDYAQJGQEJA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-N'-phenylcarbamimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N'-phenylcarbamimidoyl bromide?
The IUPAC name of N-acetyl-N'-phenylcarbamimidoyl bromide (CID 137297946) is N-acetyl-N'-phenylcarbamimidoyl bromide.
What is the SMILES notation for N-acetyl-N'-phenylcarbamimidoyl bromide?
The canonical SMILES for N-acetyl-N'-phenylcarbamimidoyl bromide is CC(=O)N/C(Br)=N/c1ccccc1.
What is the InChIKey of N-acetyl-N'-phenylcarbamimidoyl bromide?
The InChIKey is CKQNDYAQJGQEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O/c1-7(13)11-9(10)12-8-5-3-2-4-6-8/h2-6H,1H3,(H,11,12,13).
What are the key properties of N-acetyl-N'-phenylcarbamimidoyl bromide?
N-acetyl-N'-phenylcarbamimidoyl bromide has a molecular weight of 241.09 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N'-phenylcarbamimidoyl bromide is sourced from PubChem (CID 137297946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).