C20H17N3O — CID 135454305
1-(C,N-diphenylcarbonimidoyl)-3-phenylurea (PubChem CID 135454305) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-(C,N-diphenylcarbonimidoyl)-3-phenylurea.
| Compound Name | 1-(C,N-diphenylcarbonimidoyl)-3-phenylurea |
|---|---|
| PubChem CID | 135454305 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(C,N-diphenylcarbonimidoyl)-3-phenylurea |
| SMILES | O=C(N/C(=N\c1ccccc1)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C20H17N3O/c24-20(22-18-14-8-3-9-15-18)23-19(16-10-4-1-5-11-16)21-17-12-6-2-7-13-17/h1-15H,(H2,21,22,23,24) |
| InChIKey | KHYAMGNAALMZOM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|