C19H14Cl2N2 — CID 4779422
N-(3,5-dichlorophenyl)-N'-phenylbenzenecarboximidamide (PubChem CID 4779422) has the molecular formula C19H14Cl2N2 and a molecular weight of 341.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-N'-phenylbenzenecarboximidamide.
| Compound Name | N-(3,5-dichlorophenyl)-N'-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 4779422 |
| Molecular Formula | C19H14Cl2N2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-N'-phenylbenzenecarboximidamide |
| SMILES | Clc1cc(Cl)cc(N/C(=N/c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H14Cl2N2/c20-15-11-16(21)13-18(12-15)23-19(14-7-3-1-4-8-14)22-17-9-5-2-6-10-17/h1-13H,(H,22,23) |
| InChIKey | IPWYMMZTVQIWOL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|