C36H32N6O2 — CID 135408645
1-N,4-N-bis[4-(N-methyl-N'-phenylcarbamimidoyl)phenyl]benzene-1,4-dicarboxamide (PubChem CID 135408645) has the molecular formula C36H32N6O2 and a molecular weight of 580.69 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(N-methyl-N'-phenylcarbamimidoyl)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(N-methyl-N'-phenylcarbamimidoyl)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 135408645 |
| Molecular Formula | C36H32N6O2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 1-N,4-N-bis[4-(N-methyl-N'-phenylcarbamimidoyl)phenyl]benzene-1,4-dicarboxamide |
| SMILES | CN/C(=N\c1ccccc1)c1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(/C(=N/c4ccccc4)NC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H32N6O2/c1-37-33(39-29-9-5-3-6-10-29)25-17-21-31(22-18-25)41-35(43)27-13-15-28(16-14-27)36(44)42-32-23-19-26(20-24-32)34(38-2)40-30-11-7-4-8-12-30/h3-24H,1-2H3,(H,37,39)(H,38,40)(H,41,43)(H,42,44) |
| InChIKey | CYQJLQDNYFNENI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|