C16H21GaN2 — CID 173308791
dimethylgallane;N,N'-diphenylethanimidamide (PubChem CID 173308791) has the molecular formula C16H21GaN2 and a molecular weight of 311.08 g/mol. Its IUPAC name is dimethylgallane;N,N'-diphenylethanimidamide.
| Compound Name | dimethylgallane;N,N'-diphenylethanimidamide |
|---|---|
| PubChem CID | 173308791 |
| Molecular Formula | C16H21GaN2 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | dimethylgallane;N,N'-diphenylethanimidamide |
| SMILES | C/C(=N\c1ccccc1)Nc1ccccc1.C[GaH]C |
| InChI | InChI=1S/C14H14N2.2CH3.Ga.H/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14;;;;/h2-11H,1H3,(H,15,16);2*1H3;; |
| InChIKey | ZEYYPUGYRCWEAD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|