C16H16N2S — CID 6382718
[(E)-prop-1-enyl] N,N'-diphenylcarbamimidothioate (PubChem CID 6382718) has the molecular formula C16H16N2S and a molecular weight of 268.39 g/mol. Its IUPAC name is [(E)-prop-1-enyl] N,N'-diphenylcarbamimidothioate.
| Compound Name | [(E)-prop-1-enyl] N,N'-diphenylcarbamimidothioate |
|---|---|
| PubChem CID | 6382718 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [(E)-prop-1-enyl] N,N'-diphenylcarbamimidothioate |
| SMILES | C/C=C/S/C(=N/c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N2S/c1-2-13-19-16(17-14-9-5-3-6-10-14)18-15-11-7-4-8-12-15/h2-13H,1H3,(H,17,18)/b13-2+ |
| InChIKey | YDKYFODTSPCZQY-XNJYKOPJSA-N |
| XLogP | 5.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|