About 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide
3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide (PubChem CID 173491524) has the molecular formula C18H20N4
and a molecular weight of 292.39 g/mol. Its IUPAC name is 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide.
Molecular Properties
| Compound Name | 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide |
| PubChem CID | 173491524 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide |
| SMILES | C=C(NC(C)=C/C(N)=N/c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N4/c1-14(13-18(19)22-17-11-7-4-8-12-17)20-15(2)21-16-9-5-3-6-10-16/h3-13,20-21H,2H2,1H3,(H2,19,22) |
| InChIKey | BBGGKBZXSYCXPV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide?
The IUPAC name of 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide (CID 173491524) is 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide.
What is the SMILES notation for 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide?
The canonical SMILES for 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide is C=C(NC(C)=C/C(N)=N/c1ccccc1)Nc1ccccc1.
What is the InChIKey of 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide?
The InChIKey is BBGGKBZXSYCXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4/c1-14(13-18(19)22-17-11-7-4-8-12-17)20-15(2)21-16-9-5-3-6-10-16/h3-13,20-21H,2H2,1H3,(H2,19,22).
What are the key properties of 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide?
3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide has a molecular weight of 292.39 g/mol, XLogP of 3.75, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-anilinoethenylamino)-N'-phenylbut-2-enimidamide is sourced from PubChem (CID 173491524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).