C17H17N — CID 167145828
N-[(3E)-4-phenylpenta-1,3-dien-2-yl]aniline (PubChem CID 167145828) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[(3E)-4-phenylpenta-1,3-dien-2-yl]aniline.
| Compound Name | N-[(3E)-4-phenylpenta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 167145828 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[(3E)-4-phenylpenta-1,3-dien-2-yl]aniline |
| SMILES | C=C(/C=C(\C)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C17H17N/c1-14(16-9-5-3-6-10-16)13-15(2)18-17-11-7-4-8-12-17/h3-13,18H,2H2,1H3/b14-13+ |
| InChIKey | ROFRUEIVWYYLHN-BUHFOSPRSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|