C14H14N2 — CID 18406310
1-N,1-N'-diphenylethene-1,1-diamine (PubChem CID 18406310) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-N,1-N'-diphenylethene-1,1-diamine.
| Compound Name | 1-N,1-N'-diphenylethene-1,1-diamine |
|---|---|
| PubChem CID | 18406310 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-N,1-N'-diphenylethene-1,1-diamine |
| SMILES | C=C(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C14H14N2/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14/h2-11,15-16H,1H2 |
| InChIKey | NSTGAHOUUUYTTH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |