C12H12BrN — CID 156868377
N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]aniline (PubChem CID 156868377) has the molecular formula C12H12BrN and a molecular weight of 250.14 g/mol. Its IUPAC name is N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]aniline.
| Compound Name | N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]aniline |
|---|---|
| PubChem CID | 156868377 |
| Molecular Formula | C12H12BrN |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]aniline |
| SMILES | C=C(Br)/C=C\C(=C)Nc1ccccc1 |
| InChI | InChI=1S/C12H12BrN/c1-10(13)8-9-11(2)14-12-6-4-3-5-7-12/h3-9,14H,1-2H2/b9-8- |
| InChIKey | GRNZAILEQXBUEA-HJWRWDBZSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|