C10H14N2 — CID 131994247
1-N',1-N'-dimethyl-1-N-phenylethene-1,1-diamine (PubChem CID 131994247) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-N',1-N'-dimethyl-1-N-phenylethene-1,1-diamine.
| Compound Name | 1-N',1-N'-dimethyl-1-N-phenylethene-1,1-diamine |
|---|---|
| PubChem CID | 131994247 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-N',1-N'-dimethyl-1-N-phenylethene-1,1-diamine |
| SMILES | C=C(Nc1ccccc1)N(C)C |
| InChI | InChI=1S/C10H14N2/c1-9(12(2)3)11-10-7-5-4-6-8-10/h4-8,11H,1H2,2-3H3 |
| InChIKey | CBVRRLLYONCICP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |