About N-(1,2-dibromoethenyl)aniline
N-(1,2-dibromoethenyl)aniline (PubChem CID 173162967) has the molecular formula C8H7Br2N
and a molecular weight of 276.96 g/mol. Its IUPAC name is N-(1,2-dibromoethenyl)aniline.
Molecular Properties
| Compound Name | N-(1,2-dibromoethenyl)aniline |
| PubChem CID | 173162967 |
| Molecular Formula | C8H7Br2N |
| Molecular Weight | 276.96 g/mol |
| Exact Mass | 274.89 |
| IUPAC Name | N-(1,2-dibromoethenyl)aniline |
| SMILES | BrC=C(Br)Nc1ccccc1 |
| InChI | InChI=1S/C8H7Br2N/c9-6-8(10)11-7-4-2-1-3-5-7/h1-6,11H |
| InChIKey | IFRKEVFJMBEIGS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.96 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,2-dibromoethenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-dibromoethenyl)aniline?
The IUPAC name of N-(1,2-dibromoethenyl)aniline (CID 173162967) is N-(1,2-dibromoethenyl)aniline.
What is the SMILES notation for N-(1,2-dibromoethenyl)aniline?
The canonical SMILES for N-(1,2-dibromoethenyl)aniline is BrC=C(Br)Nc1ccccc1.
What is the InChIKey of N-(1,2-dibromoethenyl)aniline?
The InChIKey is IFRKEVFJMBEIGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2N/c9-6-8(10)11-7-4-2-1-3-5-7/h1-6,11H.
What are the key properties of N-(1,2-dibromoethenyl)aniline?
N-(1,2-dibromoethenyl)aniline has a molecular weight of 276.96 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-dibromoethenyl)aniline is sourced from PubChem (CID 173162967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).