About aniline;phenylcarbamic acid
aniline;phenylcarbamic acid (PubChem CID 173402321) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is aniline;phenylcarbamic acid.
Molecular Properties
| Compound Name | aniline;phenylcarbamic acid |
| PubChem CID | 173402321 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | aniline;phenylcarbamic acid |
| SMILES | Nc1ccccc1.O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.C6H7N/c9-7(10)8-6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5,8H,(H,9,10);1-5H,7H2 |
| InChIKey | YDZPKLLLELHBLM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;phenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;phenylcarbamic acid?
The IUPAC name of aniline;phenylcarbamic acid (CID 173402321) is aniline;phenylcarbamic acid.
What is the SMILES notation for aniline;phenylcarbamic acid?
The canonical SMILES for aniline;phenylcarbamic acid is Nc1ccccc1.O=C(O)Nc1ccccc1.
What is the InChIKey of aniline;phenylcarbamic acid?
The InChIKey is YDZPKLLLELHBLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H7N/c9-7(10)8-6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5,8H,(H,9,10);1-5H,7H2.
What are the key properties of aniline;phenylcarbamic acid?
aniline;phenylcarbamic acid has a molecular weight of 230.27 g/mol, XLogP of 3.05, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;phenylcarbamic acid is sourced from PubChem (CID 173402321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).