About molecular hydrogen;phenylurea
molecular hydrogen;phenylurea (PubChem CID 143657584) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is molecular hydrogen;phenylurea.
Molecular Properties
| Compound Name | molecular hydrogen;phenylurea |
| PubChem CID | 143657584 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | molecular hydrogen;phenylurea |
| SMILES | NC(=O)Nc1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C7H8N2O.2H2/c8-7(10)9-6-4-2-1-3-5-6;;/h1-5H,(H3,8,9,10);2*1H |
| InChIKey | XKCWDCGARKJRAX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;phenylurea?
The IUPAC name of molecular hydrogen;phenylurea (CID 143657584) is molecular hydrogen;phenylurea.
What is the SMILES notation for molecular hydrogen;phenylurea?
The canonical SMILES for molecular hydrogen;phenylurea is NC(=O)Nc1ccccc1.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;phenylurea?
The InChIKey is XKCWDCGARKJRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.2H2/c8-7(10)9-6-4-2-1-3-5-6;;/h1-5H,(H3,8,9,10);2*1H.
What are the key properties of molecular hydrogen;phenylurea?
molecular hydrogen;phenylurea has a molecular weight of 140.19 g/mol, XLogP of 1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;phenylurea is sourced from PubChem (CID 143657584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).