About (carbamoylamino) N-phenylcarbamodithioate
(carbamoylamino) N-phenylcarbamodithioate (PubChem CID 174413845) has the molecular formula C8H9N3OS2
and a molecular weight of 227.31 g/mol. Its IUPAC name is (carbamoylamino) N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | (carbamoylamino) N-phenylcarbamodithioate |
| PubChem CID | 174413845 |
| Molecular Formula | C8H9N3OS2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | (carbamoylamino) N-phenylcarbamodithioate |
| SMILES | NC(=O)NSC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C8H9N3OS2/c9-7(12)11-14-8(13)10-6-4-2-1-3-5-6/h1-5H,(H,10,13)(H3,9,11,12) |
| InChIKey | VCOHECSJWMSMFS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (carbamoylamino) N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carbamoylamino) N-phenylcarbamodithioate?
The IUPAC name of (carbamoylamino) N-phenylcarbamodithioate (CID 174413845) is (carbamoylamino) N-phenylcarbamodithioate.
What is the SMILES notation for (carbamoylamino) N-phenylcarbamodithioate?
The canonical SMILES for (carbamoylamino) N-phenylcarbamodithioate is NC(=O)NSC(=S)Nc1ccccc1.
What is the InChIKey of (carbamoylamino) N-phenylcarbamodithioate?
The InChIKey is VCOHECSJWMSMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS2/c9-7(12)11-14-8(13)10-6-4-2-1-3-5-6/h1-5H,(H,10,13)(H3,9,11,12).
What are the key properties of (carbamoylamino) N-phenylcarbamodithioate?
(carbamoylamino) N-phenylcarbamodithioate has a molecular weight of 227.31 g/mol, XLogP of 1.70, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (carbamoylamino) N-phenylcarbamodithioate is sourced from PubChem (CID 174413845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).