About sodium;hydride;phenylthiourea
sodium;hydride;phenylthiourea (PubChem CID 174376840) has the molecular formula C7H9N2NaS
and a molecular weight of 176.22 g/mol. Its IUPAC name is sodium;hydride;phenylthiourea.
Molecular Properties
| Compound Name | sodium;hydride;phenylthiourea |
| PubChem CID | 174376840 |
| Molecular Formula | C7H9N2NaS |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | sodium;hydride;phenylthiourea |
| SMILES | NC(=S)Nc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C7H8N2S.Na.H/c8-7(10)9-6-4-2-1-3-5-6;;/h1-5H,(H3,8,9,10);;/q;+1;-1 |
| InChIKey | APQVSZIUCAIAKL-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenylthiourea?
The IUPAC name of sodium;hydride;phenylthiourea (CID 174376840) is sodium;hydride;phenylthiourea.
What is the SMILES notation for sodium;hydride;phenylthiourea?
The canonical SMILES for sodium;hydride;phenylthiourea is NC(=S)Nc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenylthiourea?
The InChIKey is APQVSZIUCAIAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S.Na.H/c8-7(10)9-6-4-2-1-3-5-6;;/h1-5H,(H3,8,9,10);;/q;+1;-1.
What are the key properties of sodium;hydride;phenylthiourea?
sodium;hydride;phenylthiourea has a molecular weight of 176.22 g/mol, XLogP of -1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenylthiourea is sourced from PubChem (CID 174376840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).