About phenylcarbamodithioic acid;hydrochloride
phenylcarbamodithioic acid;hydrochloride (PubChem CID 141118460) has the molecular formula C7H8ClNS2
and a molecular weight of 205.74 g/mol. Its IUPAC name is phenylcarbamodithioic acid;hydrochloride.
Molecular Properties
| Compound Name | phenylcarbamodithioic acid;hydrochloride |
| PubChem CID | 141118460 |
| Molecular Formula | C7H8ClNS2 |
| Molecular Weight | 205.74 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | phenylcarbamodithioic acid;hydrochloride |
| SMILES | Cl.S=C(S)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NS2.ClH/c9-7(10)8-6-4-2-1-3-5-6;/h1-5H,(H2,8,9,10);1H |
| InChIKey | WWTUUEFNVQWQQP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze phenylcarbamodithioic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylcarbamodithioic acid;hydrochloride?
The IUPAC name of phenylcarbamodithioic acid;hydrochloride (CID 141118460) is phenylcarbamodithioic acid;hydrochloride.
What is the SMILES notation for phenylcarbamodithioic acid;hydrochloride?
The canonical SMILES for phenylcarbamodithioic acid;hydrochloride is Cl.S=C(S)Nc1ccccc1.
What is the InChIKey of phenylcarbamodithioic acid;hydrochloride?
The InChIKey is WWTUUEFNVQWQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS2.ClH/c9-7(10)8-6-4-2-1-3-5-6;/h1-5H,(H2,8,9,10);1H.
What are the key properties of phenylcarbamodithioic acid;hydrochloride?
phenylcarbamodithioic acid;hydrochloride has a molecular weight of 205.74 g/mol, XLogP of 2.73, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylcarbamodithioic acid;hydrochloride is sourced from PubChem (CID 141118460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).